C25H26F4O4 — CID 175202278
4-fluorobutyl 2-hydroxy-3-(3-methylbut-2-enyl)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzenecarboperoxoate (PubChem CID 175202278) has the molecular formula C25H26F4O4 and a molecular weight of 466.47 g/mol. Its IUPAC name is 4-fluorobutyl 2-hydroxy-3-(3-methylbut-2-enyl)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzenecarboperoxoate.
| Compound Name | 4-fluorobutyl 2-hydroxy-3-(3-methylbut-2-enyl)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 175202278 |
| Molecular Formula | C25H26F4O4 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 4-fluorobutyl 2-hydroxy-3-(3-methylbut-2-enyl)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzenecarboperoxoate |
| SMILES | CC(C)=CCc1ccc(C=Cc2ccc(C(F)(F)F)cc2)c(C(=O)OOCCCCF)c1O |
| InChI | InChI=1S/C25H26F4O4/c1-17(2)5-9-20-12-11-19(10-6-18-7-13-21(14-8-18)25(27,28)29)22(23(20)30)24(31)33-32-16-4-3-15-26/h5-8,10-14,30H,3-4,9,15-16H2,1-2H3 |
| InChIKey | LQGPLKNIPFDAEV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|