C19H15F5O4 — CID 163207569
methyl 4-(2,2-difluoroethoxy)-2-hydroxy-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate (PubChem CID 163207569) has the molecular formula C19H15F5O4 and a molecular weight of 402.32 g/mol. Its IUPAC name is methyl 4-(2,2-difluoroethoxy)-2-hydroxy-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate.
| Compound Name | methyl 4-(2,2-difluoroethoxy)-2-hydroxy-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 163207569 |
| Molecular Formula | C19H15F5O4 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | methyl 4-(2,2-difluoroethoxy)-2-hydroxy-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1c(O)cc(OCC(F)F)cc1/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F5O4/c1-27-18(26)17-12(8-14(9-15(17)25)28-10-16(20)21)5-2-11-3-6-13(7-4-11)19(22,23)24/h2-9,16,25H,10H2,1H3/b5-2+ |
| InChIKey | FCUVYVQAIQJFJH-GORDUTHDSA-N |
| XLogP | 5.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|