C23H25F3O4 — CID 175426325
methyl 4-hexan-3-yloxy-2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate (PubChem CID 175426325) has the molecular formula C23H25F3O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl 4-hexan-3-yloxy-2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate.
| Compound Name | methyl 4-hexan-3-yloxy-2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 175426325 |
| Molecular Formula | C23H25F3O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | methyl 4-hexan-3-yloxy-2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
| SMILES | CCCC(CC)Oc1cc(O)c(C(=O)OC)c(C=Cc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C23H25F3O4/c1-4-6-18(5-2)30-19-13-16(21(20(27)14-19)22(28)29-3)10-7-15-8-11-17(12-9-15)23(24,25)26/h7-14,18,27H,4-6H2,1-3H3 |
| InChIKey | WFWDYNTWZKKYEH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|