C23H19FO4 — CID 163207609
methyl 2-[(E)-2-(4-fluorophenyl)ethenyl]-6-hydroxy-4-phenylmethoxybenzoate (PubChem CID 163207609) has the molecular formula C23H19FO4 and a molecular weight of 378.40 g/mol. Its IUPAC name is methyl 2-[(E)-2-(4-fluorophenyl)ethenyl]-6-hydroxy-4-phenylmethoxybenzoate.
| Compound Name | methyl 2-[(E)-2-(4-fluorophenyl)ethenyl]-6-hydroxy-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 163207609 |
| Molecular Formula | C23H19FO4 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | methyl 2-[(E)-2-(4-fluorophenyl)ethenyl]-6-hydroxy-4-phenylmethoxybenzoate |
| SMILES | COC(=O)c1c(O)cc(OCc2ccccc2)cc1/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C23H19FO4/c1-27-23(26)22-18(10-7-16-8-11-19(24)12-9-16)13-20(14-21(22)25)28-15-17-5-3-2-4-6-17/h2-14,25H,15H2,1H3/b10-7+ |
| InChIKey | MFCVYDSNYFLAFO-JXMROGBWSA-N |
| XLogP | 5.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|