C19H20O6 — CID 154074888
methyl 2-[2-(2,6-dimethoxyphenyl)ethenyl]-6-hydroxy-4-methoxybenzoate (PubChem CID 154074888) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is methyl 2-[2-(2,6-dimethoxyphenyl)ethenyl]-6-hydroxy-4-methoxybenzoate.
| Compound Name | methyl 2-[2-(2,6-dimethoxyphenyl)ethenyl]-6-hydroxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 154074888 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methyl 2-[2-(2,6-dimethoxyphenyl)ethenyl]-6-hydroxy-4-methoxybenzoate |
| SMILES | COC(=O)c1c(O)cc(OC)cc1C=Cc1c(OC)cccc1OC |
| InChI | InChI=1S/C19H20O6/c1-22-13-10-12(18(15(20)11-13)19(21)25-4)8-9-14-16(23-2)6-5-7-17(14)24-3/h5-11,20H,1-4H3 |
| InChIKey | TXLTVVWGKCHHFF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|