C16H16O5 — CID 141364342
methyl 2-[(Z)-2-(furan-2-yl)ethenyl]-4,6-dimethoxybenzoate (PubChem CID 141364342) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl 2-[(Z)-2-(furan-2-yl)ethenyl]-4,6-dimethoxybenzoate.
| Compound Name | methyl 2-[(Z)-2-(furan-2-yl)ethenyl]-4,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 141364342 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | methyl 2-[(Z)-2-(furan-2-yl)ethenyl]-4,6-dimethoxybenzoate |
| SMILES | COC(=O)c1c(/C=C\c2ccco2)cc(OC)cc1OC |
| InChI | InChI=1S/C16H16O5/c1-18-13-9-11(6-7-12-5-4-8-21-12)15(16(17)20-3)14(10-13)19-2/h4-10H,1-3H3/b7-6- |
| InChIKey | FMWJQBUMLBDNSH-SREVYHEPSA-N |
| XLogP | 3.25 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |