C33H32O11 — CID 70551644
3-(furan-2-yl)-1-(2-hydroxy-4,6-dimethoxyphenyl)prop-2-en-1-one;[2-[3-(furan-2-yl)prop-2-enoyl]-3,5-dimethoxyphenyl] propanoate (PubChem CID 70551644) has the molecular formula C33H32O11 and a molecular weight of 604.61 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-(2-hydroxy-4,6-dimethoxyphenyl)prop-2-en-1-one;[2-[3-(furan-2-yl)prop-2-enoyl]-3,5-dimethoxyphenyl] propanoate.
| Compound Name | 3-(furan-2-yl)-1-(2-hydroxy-4,6-dimethoxyphenyl)prop-2-en-1-one;[2-[3-(furan-2-yl)prop-2-enoyl]-3,5-dimethoxyphenyl] propanoate |
|---|---|
| PubChem CID | 70551644 |
| Molecular Formula | C33H32O11 |
| Molecular Weight | 604.61 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 3-(furan-2-yl)-1-(2-hydroxy-4,6-dimethoxyphenyl)prop-2-en-1-one;[2-[3-(furan-2-yl)prop-2-enoyl]-3,5-dimethoxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(OC)cc(OC)c1C(=O)C=Cc1ccco1.COc1cc(O)c(C(=O)C=Cc2ccco2)c(OC)c1 |
| InChI | InChI=1S/C18H18O6.C15H14O5/c1-4-17(20)24-16-11-13(21-2)10-15(22-3)18(16)14(19)8-7-12-6-5-9-23-12;1-18-11-8-13(17)15(14(9-11)19-2)12(16)6-5-10-4-3-7-20-10/h5-11H,4H2,1-3H3;3-9,17H,1-2H3 |
| InChIKey | BPAZQIVHGDUIOJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 143.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|