C18H18O4S — CID 6440299
(E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one (PubChem CID 6440299) has the molecular formula C18H18O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6440299 |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(O)c(C(=O)/C=C/c2ccc(SC)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H18O4S/c1-21-13-10-16(20)18(17(11-13)22-2)15(19)9-6-12-4-7-14(23-3)8-5-12/h4-11,20H,1-3H3/b9-6+ |
| InChIKey | UAHKGRIMCHVSAP-RMKNXTFCSA-N |
| XLogP | 4.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|