C26H32N2O6 — CID 155541094
tert-butyl 4-[4-[(E)-3-(2-hydroxy-4,6-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate (PubChem CID 155541094) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is tert-butyl 4-[4-[(E)-3-(2-hydroxy-4,6-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(E)-3-(2-hydroxy-4,6-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155541094 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | tert-butyl 4-[4-[(E)-3-(2-hydroxy-4,6-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl]piperazine-1-carboxylate |
| SMILES | COc1cc(O)c(C(=O)/C=C/c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)c(OC)c1 |
| InChI | InChI=1S/C26H32N2O6/c1-26(2,3)34-25(31)28-14-12-27(13-15-28)19-9-6-18(7-10-19)8-11-21(29)24-22(30)16-20(32-4)17-23(24)33-5/h6-11,16-17,30H,12-15H2,1-5H3/b11-8+ |
| InChIKey | FOQWJOQJVCTWRN-DHZHZOJOSA-N |
| XLogP | 4.36 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|