C23H23F5N2O2 — CID 102261727
tert-butyl 4-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenyl]piperazine-1-carboxylate (PubChem CID 102261727) has the molecular formula C23H23F5N2O2 and a molecular weight of 454.44 g/mol. Its IUPAC name is tert-butyl 4-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 102261727 |
| Molecular Formula | C23H23F5N2O2 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | tert-butyl 4-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(/C=C/c3c(F)c(F)c(F)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C23H23F5N2O2/c1-23(2,3)32-22(31)30-12-10-29(11-13-30)15-7-4-14(5-8-15)6-9-16-17(24)19(26)21(28)20(27)18(16)25/h4-9H,10-13H2,1-3H3/b9-6+ |
| InChIKey | LOXCNYIYBWTFON-RMKNXTFCSA-N |
| XLogP | 5.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|