C31H45N3O2 — CID 68617399
tert-butyl 4-[4-[2-[4-(dibutylamino)phenyl]ethenyl]phenyl]piperazine-1-carboxylate (PubChem CID 68617399) has the molecular formula C31H45N3O2 and a molecular weight of 491.72 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-[4-(dibutylamino)phenyl]ethenyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-[4-(dibutylamino)phenyl]ethenyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68617399 |
| Molecular Formula | C31H45N3O2 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | tert-butyl 4-[4-[2-[4-(dibutylamino)phenyl]ethenyl]phenyl]piperazine-1-carboxylate |
| SMILES | CCCCN(CCCC)c1ccc(C=Cc2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H45N3O2/c1-6-8-20-32(21-9-7-2)28-16-12-26(13-17-28)10-11-27-14-18-29(19-15-27)33-22-24-34(25-23-33)30(35)36-31(3,4)5/h10-19H,6-9,20-25H2,1-5H3 |
| InChIKey | BUZGANBPZFTJPM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|