C44H50N3S+ — CID 59850647
[4-[4-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]phenyl]piperazin-1-yl]phenyl]-diphenylsulfanium (PubChem CID 59850647) has the molecular formula C44H50N3S+ and a molecular weight of 652.97 g/mol. Its IUPAC name is [4-[4-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]phenyl]piperazin-1-yl]phenyl]-diphenylsulfanium.
| Compound Name | [4-[4-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]phenyl]piperazin-1-yl]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 59850647 |
| Molecular Formula | C44H50N3S+ |
| Molecular Weight | 652.97 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | [4-[4-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]phenyl]piperazin-1-yl]phenyl]-diphenylsulfanium |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2ccc(N3CCN(c4ccc([S+](c5ccccc5)c5ccccc5)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C44H50N3S/c1-3-5-31-45(32-6-4-2)39-23-19-37(20-24-39)17-18-38-21-25-40(26-22-38)46-33-35-47(36-34-46)41-27-29-44(30-28-41)48(42-13-9-7-10-14-42)43-15-11-8-12-16-43/h7-30H,3-6,31-36H2,1-2H3/q+1/b18-17+ |
| InChIKey | IHHINSCQDHKLSC-ISLYRVAYSA-N |
| XLogP | 10.69 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.97 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|