C23H38N2O2 — CID 167031186
ethyl 2-[1-[4-(dibutylamino)phenyl]piperidin-4-yl]acetate (PubChem CID 167031186) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is ethyl 2-[1-[4-(dibutylamino)phenyl]piperidin-4-yl]acetate.
| Compound Name | ethyl 2-[1-[4-(dibutylamino)phenyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 167031186 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | ethyl 2-[1-[4-(dibutylamino)phenyl]piperidin-4-yl]acetate |
| SMILES | CCCCN(CCCC)c1ccc(N2CCC(CC(=O)OCC)CC2)cc1 |
| InChI | InChI=1S/C23H38N2O2/c1-4-7-15-24(16-8-5-2)21-9-11-22(12-10-21)25-17-13-20(14-18-25)19-23(26)27-6-3/h9-12,20H,4-8,13-19H2,1-3H3 |
| InChIKey | NOPFPTZPFKHKEX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|