C21H36N2 — CID 174155713
N,N-dibutyl-4-(4-ethylpiperidin-1-yl)aniline (PubChem CID 174155713) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is N,N-dibutyl-4-(4-ethylpiperidin-1-yl)aniline.
| Compound Name | N,N-dibutyl-4-(4-ethylpiperidin-1-yl)aniline |
|---|---|
| PubChem CID | 174155713 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | N,N-dibutyl-4-(4-ethylpiperidin-1-yl)aniline |
| SMILES | CCCCN(CCCC)c1ccc(N2CCC(CC)CC2)cc1 |
| InChI | InChI=1S/C21H36N2/c1-4-7-15-22(16-8-5-2)20-9-11-21(12-10-20)23-17-13-19(6-3)14-18-23/h9-12,19H,4-8,13-18H2,1-3H3 |
| InChIKey | FKNPLXFECHWEGT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|