C24H36N2O — CID 159818534
N,N-dibutylaniline;4-phenylmorpholine (PubChem CID 159818534) has the molecular formula C24H36N2O and a molecular weight of 368.56 g/mol. Its IUPAC name is N,N-dibutylaniline;4-phenylmorpholine.
| Compound Name | N,N-dibutylaniline;4-phenylmorpholine |
|---|---|
| PubChem CID | 159818534 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | N,N-dibutylaniline;4-phenylmorpholine |
| SMILES | CCCCN(CCCC)c1ccccc1.c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H23N.C10H13NO/c1-3-5-12-15(13-6-4-2)14-10-8-7-9-11-14;1-2-4-10(5-3-1)11-6-8-12-9-7-11/h7-11H,3-6,12-13H2,1-2H3;1-5H,6-9H2 |
| InChIKey | NLXXCZMXLOOGEE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |