C9H11NO — CID 519787
3-phenyl-1,3-oxazolidine (PubChem CID 519787) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-phenyl-1,3-oxazolidine.
| Compound Name | 3-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 519787 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-phenyl-1,3-oxazolidine |
| SMILES | c1ccc(N2CCOC2)cc1 |
| InChI | InChI=1S/C9H11NO/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-5H,6-8H2 |
| InChIKey | ITSRLVMSQHOSEC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |