C17H27NO6 — CID 88924597
2-phenyl-1,4,7,10,13,16-hexaoxa-2-azacyclooctadecane (PubChem CID 88924597) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is 2-phenyl-1,4,7,10,13,16-hexaoxa-2-azacyclooctadecane.
| Compound Name | 2-phenyl-1,4,7,10,13,16-hexaoxa-2-azacyclooctadecane |
|---|---|
| PubChem CID | 88924597 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-phenyl-1,4,7,10,13,16-hexaoxa-2-azacyclooctadecane |
| SMILES | c1ccc(N2COCCOCCOCCOCCOCCO2)cc1 |
| InChI | InChI=1S/C17H27NO6/c1-2-4-17(5-3-1)18-16-23-13-12-21-9-8-19-6-7-20-10-11-22-14-15-24-18/h1-5H,6-16H2 |
| InChIKey | LKORZDUOZBAUSS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |