C8H11N3O — CID 18788470
4-phenyl-1,2,4-oxadiazolidin-2-amine (PubChem CID 18788470) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-phenyl-1,2,4-oxadiazolidin-2-amine.
| Compound Name | 4-phenyl-1,2,4-oxadiazolidin-2-amine |
|---|---|
| PubChem CID | 18788470 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-phenyl-1,2,4-oxadiazolidin-2-amine |
| SMILES | NN1CN(c2ccccc2)CO1 |
| InChI | InChI=1S/C8H11N3O/c9-11-6-10(7-12-11)8-4-2-1-3-5-8/h1-5H,6-7,9H2 |
| InChIKey | XTBJSNPQJNERPB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|