About 2,3-diphenyloxadiaziridine
2,3-diphenyloxadiaziridine (PubChem CID 67418852) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2,3-diphenyloxadiaziridine.
Molecular Properties
| Compound Name | 2,3-diphenyloxadiaziridine |
| PubChem CID | 67418852 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2,3-diphenyloxadiaziridine |
| SMILES | c1ccc(-n2on2-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N2O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-10H |
| InChIKey | PHBIRVKCLTUUIQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 23.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-diphenyloxadiaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenyloxadiaziridine?
The IUPAC name of 2,3-diphenyloxadiaziridine (CID 67418852) is 2,3-diphenyloxadiaziridine.
What is the SMILES notation for 2,3-diphenyloxadiaziridine?
The canonical SMILES for 2,3-diphenyloxadiaziridine is c1ccc(-n2on2-c2ccccc2)cc1.
What is the InChIKey of 2,3-diphenyloxadiaziridine?
The InChIKey is PHBIRVKCLTUUIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 2,3-diphenyloxadiaziridine?
2,3-diphenyloxadiaziridine has a molecular weight of 198.22 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenyloxadiaziridine is sourced from PubChem (CID 67418852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).