C11H13NO — CID 142853569
6-methyl-3-phenyl-2,4-dihydro-1,3-oxazine (PubChem CID 142853569) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 6-methyl-3-phenyl-2,4-dihydro-1,3-oxazine.
| Compound Name | 6-methyl-3-phenyl-2,4-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 142853569 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 6-methyl-3-phenyl-2,4-dihydro-1,3-oxazine |
| SMILES | CC1=CCN(c2ccccc2)CO1 |
| InChI | InChI=1S/C11H13NO/c1-10-7-8-12(9-13-10)11-5-3-2-4-6-11/h2-7H,8-9H2,1H3 |
| InChIKey | WPMFEZFQYBCRKK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |