C18H24N2P2 — CID 12605483
3,7-dimethyl-1,5-diphenyl-1,5,3,7-diazadiphosphocane (PubChem CID 12605483) has the molecular formula C18H24N2P2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 3,7-dimethyl-1,5-diphenyl-1,5,3,7-diazadiphosphocane.
| Compound Name | 3,7-dimethyl-1,5-diphenyl-1,5,3,7-diazadiphosphocane |
|---|---|
| PubChem CID | 12605483 |
| Molecular Formula | C18H24N2P2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3,7-dimethyl-1,5-diphenyl-1,5,3,7-diazadiphosphocane |
| SMILES | CP1CN(c2ccccc2)CP(C)CN(c2ccccc2)C1 |
| InChI | InChI=1S/C18H24N2P2/c1-21-13-19(17-9-5-3-6-10-17)15-22(2)16-20(14-21)18-11-7-4-8-12-18/h3-12H,13-16H2,1-2H3 |
| InChIKey | DVTYKRCPKGJEAE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|