About ethane;molecular hydrogen;1-phenylpiperazine
ethane;molecular hydrogen;1-phenylpiperazine (PubChem CID 144544571) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;molecular hydrogen;1-phenylpiperazine.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;1-phenylpiperazine |
| PubChem CID | 144544571 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | ethane;molecular hydrogen;1-phenylpiperazine |
| SMILES | CC.[H][H].c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C10H14N2.C2H6.H2/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;1-2;/h1-5,11H,6-9H2;1-2H3;1H |
| InChIKey | NULADVSPAKJNRJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;molecular hydrogen;1-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;1-phenylpiperazine?
The IUPAC name of ethane;molecular hydrogen;1-phenylpiperazine (CID 144544571) is ethane;molecular hydrogen;1-phenylpiperazine.
What is the SMILES notation for ethane;molecular hydrogen;1-phenylpiperazine?
The canonical SMILES for ethane;molecular hydrogen;1-phenylpiperazine is CC.[H][H].c1ccc(N2CCNCC2)cc1.
What is the InChIKey of ethane;molecular hydrogen;1-phenylpiperazine?
The InChIKey is NULADVSPAKJNRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.C2H6.H2/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;1-2;/h1-5,11H,6-9H2;1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;1-phenylpiperazine?
ethane;molecular hydrogen;1-phenylpiperazine has a molecular weight of 194.32 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;1-phenylpiperazine is sourced from PubChem (CID 144544571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).