About aniline;1-phenylpiperazine
aniline;1-phenylpiperazine (PubChem CID 175572624) has the molecular formula C16H21N3
and a molecular weight of 255.37 g/mol. Its IUPAC name is aniline;1-phenylpiperazine.
Molecular Properties
| Compound Name | aniline;1-phenylpiperazine |
| PubChem CID | 175572624 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | aniline;1-phenylpiperazine |
| SMILES | Nc1ccccc1.c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C10H14N2.C6H7N/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;7-6-4-2-1-3-5-6/h1-5,11H,6-9H2;1-5H,7H2 |
| InChIKey | HOZSTURIDJMNHX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;1-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;1-phenylpiperazine?
The IUPAC name of aniline;1-phenylpiperazine (CID 175572624) is aniline;1-phenylpiperazine.
What is the SMILES notation for aniline;1-phenylpiperazine?
The canonical SMILES for aniline;1-phenylpiperazine is Nc1ccccc1.c1ccc(N2CCNCC2)cc1.
What is the InChIKey of aniline;1-phenylpiperazine?
The InChIKey is HOZSTURIDJMNHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.C6H7N/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;7-6-4-2-1-3-5-6/h1-5,11H,6-9H2;1-5H,7H2.
What are the key properties of aniline;1-phenylpiperazine?
aniline;1-phenylpiperazine has a molecular weight of 255.37 g/mol, XLogP of 2.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;1-phenylpiperazine is sourced from PubChem (CID 175572624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).