About 1-phenylimidazolidine;thiourea
1-phenylimidazolidine;thiourea (PubChem CID 88707385) has the molecular formula C10H16N4S
and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-phenylimidazolidine;thiourea.
Molecular Properties
| Compound Name | 1-phenylimidazolidine;thiourea |
| PubChem CID | 88707385 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-phenylimidazolidine;thiourea |
| SMILES | NC(N)=S.c1ccc(N2CCNC2)cc1 |
| InChI | InChI=1S/C9H12N2.CH4N2S/c1-2-4-9(5-3-1)11-7-6-10-8-11;2-1(3)4/h1-5,10H,6-8H2;(H4,2,3,4) |
| InChIKey | TUBPYWQZSVKTSZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylimidazolidine;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylimidazolidine;thiourea?
The IUPAC name of 1-phenylimidazolidine;thiourea (CID 88707385) is 1-phenylimidazolidine;thiourea.
What is the SMILES notation for 1-phenylimidazolidine;thiourea?
The canonical SMILES for 1-phenylimidazolidine;thiourea is NC(N)=S.c1ccc(N2CCNC2)cc1.
What is the InChIKey of 1-phenylimidazolidine;thiourea?
The InChIKey is TUBPYWQZSVKTSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.CH4N2S/c1-2-4-9(5-3-1)11-7-6-10-8-11;2-1(3)4/h1-5,10H,6-8H2;(H4,2,3,4).
What are the key properties of 1-phenylimidazolidine;thiourea?
1-phenylimidazolidine;thiourea has a molecular weight of 224.33 g/mol, XLogP of 0.24, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylimidazolidine;thiourea is sourced from PubChem (CID 88707385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).