C12H18N2O2 — CID 161473217
carbamic acid;1-phenylpiperidine (PubChem CID 161473217) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is carbamic acid;1-phenylpiperidine.
| Compound Name | carbamic acid;1-phenylpiperidine |
|---|---|
| PubChem CID | 161473217 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | carbamic acid;1-phenylpiperidine |
| SMILES | NC(=O)O.c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C11H15N.CH3NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1(3)4/h1,3-4,7-8H,2,5-6,9-10H2;2H2,(H,3,4) |
| InChIKey | WDJCQKHIFGURNT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |