C15H24N2O2 — CID 67230654
(2S)-2-amino-3-methylbutanoic acid;1-phenylpyrrolidine (PubChem CID 67230654) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;1-phenylpyrrolidine.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;1-phenylpyrrolidine |
|---|---|
| PubChem CID | 67230654 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;1-phenylpyrrolidine |
| SMILES | CC(C)[C@H](N)C(=O)O.c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C10H13N.C5H11NO2/c1-2-6-10(7-3-1)11-8-4-5-9-11;1-3(2)4(6)5(7)8/h1-3,6-7H,4-5,8-9H2;3-4H,6H2,1-2H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | JIHIHOSCKYADFJ-VWMHFEHESA-N |
| XLogP | 2.34 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |