C15H24N2O — CID 174698826
butanamide;1-phenylpiperidine (PubChem CID 174698826) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is butanamide;1-phenylpiperidine.
| Compound Name | butanamide;1-phenylpiperidine |
|---|---|
| PubChem CID | 174698826 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | butanamide;1-phenylpiperidine |
| SMILES | CCCC(N)=O.c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C4H9NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-4(5)6/h1,3-4,7-8H,2,5-6,9-10H2;2-3H2,1H3,(H2,5,6) |
| InChIKey | YXXAVUAPYGZJBY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |