About ethyl formate;1-phenylpiperidine
ethyl formate;1-phenylpiperidine (PubChem CID 174893706) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is ethyl formate;1-phenylpiperidine.
Molecular Properties
| Compound Name | ethyl formate;1-phenylpiperidine |
| PubChem CID | 174893706 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | ethyl formate;1-phenylpiperidine |
| SMILES | CCOC=O.c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C3H6O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-5-3-4/h1,3-4,7-8H,2,5-6,9-10H2;3H,2H2,1H3 |
| InChIKey | RYAOMTQBDZHTHQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;1-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;1-phenylpiperidine?
The IUPAC name of ethyl formate;1-phenylpiperidine (CID 174893706) is ethyl formate;1-phenylpiperidine.
What is the SMILES notation for ethyl formate;1-phenylpiperidine?
The canonical SMILES for ethyl formate;1-phenylpiperidine is CCOC=O.c1ccc(N2CCCCC2)cc1.
What is the InChIKey of ethyl formate;1-phenylpiperidine?
The InChIKey is RYAOMTQBDZHTHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C3H6O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-5-3-4/h1,3-4,7-8H,2,5-6,9-10H2;3H,2H2,1H3.
What are the key properties of ethyl formate;1-phenylpiperidine?
ethyl formate;1-phenylpiperidine has a molecular weight of 235.33 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;1-phenylpiperidine is sourced from PubChem (CID 174893706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).