C18H31NO3Si — CID 154406169
2,2-diethoxy-9-phenyl-1-oxa-9-aza-2-silacycloundecane (PubChem CID 154406169) has the molecular formula C18H31NO3Si and a molecular weight of 337.54 g/mol. Its IUPAC name is 2,2-diethoxy-9-phenyl-1-oxa-9-aza-2-silacycloundecane.
| Compound Name | 2,2-diethoxy-9-phenyl-1-oxa-9-aza-2-silacycloundecane |
|---|---|
| PubChem CID | 154406169 |
| Molecular Formula | C18H31NO3Si |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 2,2-diethoxy-9-phenyl-1-oxa-9-aza-2-silacycloundecane |
| SMILES | CCO[Si]1(OCC)CCCCCCN(c2ccccc2)CCO1 |
| InChI | InChI=1S/C18H31NO3Si/c1-3-20-23(21-4-2)17-11-6-5-10-14-19(15-16-22-23)18-12-8-7-9-13-18/h7-9,12-13H,3-6,10-11,14-17H2,1-2H3 |
| InChIKey | VQADUYATXGVJQG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|