C17H29NO6 — CID 175305150
3-(2,3-dihydroxypropylperoxy)propane-1,2-diol;1-phenylpiperidine (PubChem CID 175305150) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylperoxy)propane-1,2-diol;1-phenylpiperidine.
| Compound Name | 3-(2,3-dihydroxypropylperoxy)propane-1,2-diol;1-phenylpiperidine |
|---|---|
| PubChem CID | 175305150 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 3-(2,3-dihydroxypropylperoxy)propane-1,2-diol;1-phenylpiperidine |
| SMILES | OCC(O)COOCC(O)CO.c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C6H14O6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-1-5(9)3-11-12-4-6(10)2-8/h1,3-4,7-8H,2,5-6,9-10H2;5-10H,1-4H2 |
| InChIKey | HKLWHPRBCIZERZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|