C19H23NO2 — CID 102036092
(1R,2S)-1-phenyl-2-(4-piperidin-1-ylphenyl)ethane-1,2-diol (PubChem CID 102036092) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1R,2S)-1-phenyl-2-(4-piperidin-1-ylphenyl)ethane-1,2-diol.
| Compound Name | (1R,2S)-1-phenyl-2-(4-piperidin-1-ylphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 102036092 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (1R,2S)-1-phenyl-2-(4-piperidin-1-ylphenyl)ethane-1,2-diol |
| SMILES | O[C@H](c1ccccc1)[C@@H](O)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H23NO2/c21-18(15-7-3-1-4-8-15)19(22)16-9-11-17(12-10-16)20-13-5-2-6-14-20/h1,3-4,7-12,18-19,21-22H,2,5-6,13-14H2/t18-,19+/m1/s1 |
| InChIKey | CDTGAMJHSJFIIS-MOPGFXCFSA-N |
| XLogP | 3.44 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|