C13H18ClNO2 — CID 171863294
3-chloro-1-(4-pyrrolidin-1-ylphenyl)propane-1,2-diol (PubChem CID 171863294) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is 3-chloro-1-(4-pyrrolidin-1-ylphenyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(4-pyrrolidin-1-ylphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171863294 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3-chloro-1-(4-pyrrolidin-1-ylphenyl)propane-1,2-diol |
| SMILES | OC(CCl)C(O)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C13H18ClNO2/c14-9-12(16)13(17)10-3-5-11(6-4-10)15-7-1-2-8-15/h3-6,12-13,16-17H,1-2,7-9H2 |
| InChIKey | LNJYXAQGXWRSCO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|