C14H23N3O2 — CID 170828993
3-amino-1-[4-(4-methylpiperazin-1-yl)phenyl]propane-1,2-diol (PubChem CID 170828993) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-amino-1-[4-(4-methylpiperazin-1-yl)phenyl]propane-1,2-diol.
| Compound Name | 3-amino-1-[4-(4-methylpiperazin-1-yl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170828993 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-amino-1-[4-(4-methylpiperazin-1-yl)phenyl]propane-1,2-diol |
| SMILES | CN1CCN(c2ccc(C(O)C(O)CN)cc2)CC1 |
| InChI | InChI=1S/C14H23N3O2/c1-16-6-8-17(9-7-16)12-4-2-11(3-5-12)14(19)13(18)10-15/h2-5,13-14,18-19H,6-10,15H2,1H3 |
| InChIKey | YIHRIHPSNUQEIH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|