C43H68N6 — CID 158500114
1-ethyl-4-(4-propan-2-ylphenyl)piperazine;bis(1-methyl-4-(4-propan-2-ylphenyl)piperazine) (PubChem CID 158500114) has the molecular formula C43H68N6 and a molecular weight of 669.06 g/mol. Its IUPAC name is 1-ethyl-4-(4-propan-2-ylphenyl)piperazine;bis(1-methyl-4-(4-propan-2-ylphenyl)piperazine).
| Compound Name | 1-ethyl-4-(4-propan-2-ylphenyl)piperazine;bis(1-methyl-4-(4-propan-2-ylphenyl)piperazine) |
|---|---|
| PubChem CID | 158500114 |
| Molecular Formula | C43H68N6 |
| Molecular Weight | 669.06 g/mol |
| Exact Mass | 668.55 |
| IUPAC Name | 1-ethyl-4-(4-propan-2-ylphenyl)piperazine;bis(1-methyl-4-(4-propan-2-ylphenyl)piperazine) |
| SMILES | CC(C)c1ccc(N2CCN(C)CC2)cc1.CC(C)c1ccc(N2CCN(C)CC2)cc1.CCN1CCN(c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C15H24N2.2C14H22N2/c1-4-16-9-11-17(12-10-16)15-7-5-14(6-8-15)13(2)3;2*1-12(2)13-4-6-14(7-5-13)16-10-8-15(3)9-11-16/h5-8,13H,4,9-12H2,1-3H3;2*4-7,12H,8-11H2,1-3H3 |
| InChIKey | HJUAFSRWDXVAFE-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.06 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|