C18H29N3O4 — CID 170829181
tert-butyl 4-[4-(3-amino-1,2-dihydroxypropyl)phenyl]piperazine-1-carboxylate (PubChem CID 170829181) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-amino-1,2-dihydroxypropyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-amino-1,2-dihydroxypropyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170829181 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | tert-butyl 4-[4-(3-amino-1,2-dihydroxypropyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(O)C(O)CN)cc2)CC1 |
| InChI | InChI=1S/C18H29N3O4/c1-18(2,3)25-17(24)21-10-8-20(9-11-21)14-6-4-13(5-7-14)16(23)15(22)12-19/h4-7,15-16,22-23H,8-12,19H2,1-3H3 |
| InChIKey | GVEWKTGRKJVUFJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|