C18H28N2O4 — CID 170833378
tert-butyl N-[2,3-dihydroxy-3-(4-pyrrolidin-1-ylphenyl)propyl]carbamate (PubChem CID 170833378) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl N-[2,3-dihydroxy-3-(4-pyrrolidin-1-ylphenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[2,3-dihydroxy-3-(4-pyrrolidin-1-ylphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 170833378 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl N-[2,3-dihydroxy-3-(4-pyrrolidin-1-ylphenyl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C18H28N2O4/c1-18(2,3)24-17(23)19-12-15(21)16(22)13-6-8-14(9-7-13)20-10-4-5-11-20/h6-9,15-16,21-22H,4-5,10-12H2,1-3H3,(H,19,23) |
| InChIKey | IYQADUYXUKTFDL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|