C12H19NO5 — CID 170831497
tert-butyl N-[3-(furan-3-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170831497) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is tert-butyl N-[3-(furan-3-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(furan-3-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170831497 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | tert-butyl N-[3-(furan-3-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1ccoc1 |
| InChI | InChI=1S/C12H19NO5/c1-12(2,3)18-11(16)13-6-9(14)10(15)8-4-5-17-7-8/h4-5,7,9-10,14-15H,6H2,1-3H3,(H,13,16) |
| InChIKey | UZUPSIFERPYOMT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |