C25H34N4O3 — CID 69450157
tert-butyl 4-[4-[(4-propan-2-ylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate (PubChem CID 69450157) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is tert-butyl 4-[4-[(4-propan-2-ylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(4-propan-2-ylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69450157 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | tert-butyl 4-[4-[(4-propan-2-ylphenyl)carbamoylamino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)c1ccc(NC(=O)Nc2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H34N4O3/c1-18(2)19-6-8-20(9-7-19)26-23(30)27-21-10-12-22(13-11-21)28-14-16-29(17-15-28)24(31)32-25(3,4)5/h6-13,18H,14-17H2,1-5H3,(H2,26,27,30) |
| InChIKey | QBJUAKDTAATBMC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|