C24H38N4O5 — CID 70287063
acetic acid;tert-butyl 4-[4-[(1-methylpiperidine-4-carbonyl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 70287063) has the molecular formula C24H38N4O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is acetic acid;tert-butyl 4-[4-[(1-methylpiperidine-4-carbonyl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | acetic acid;tert-butyl 4-[4-[(1-methylpiperidine-4-carbonyl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70287063 |
| Molecular Formula | C24H38N4O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | acetic acid;tert-butyl 4-[4-[(1-methylpiperidine-4-carbonyl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(=O)O.CN1CCC(C(=O)Nc2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)CC1 |
| InChI | InChI=1S/C22H34N4O3.C2H4O2/c1-22(2,3)29-21(28)26-15-13-25(14-16-26)19-7-5-18(6-8-19)23-20(27)17-9-11-24(4)12-10-17;1-2(3)4/h5-8,17H,9-16H2,1-4H3,(H,23,27);1H3,(H,3,4) |
| InChIKey | KMMXMDCFEWMGJZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|