C22H33N3O2 — CID 42663766
N-[4-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]phenyl]cyclopentanecarboxamide (PubChem CID 42663766) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-[4-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[4-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42663766 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-[4-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]phenyl]cyclopentanecarboxamide |
| SMILES | CC(C)(C)CC(=O)N1CCN(c2ccc(NC(=O)C3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H33N3O2/c1-22(2,3)16-20(26)25-14-12-24(13-15-25)19-10-8-18(9-11-19)23-21(27)17-6-4-5-7-17/h8-11,17H,4-7,12-16H2,1-3H3,(H,23,27) |
| InChIKey | GFTBWLKDCHPYDI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|