C20H31N5OS2 — CID 72644805
ethyl N'-[[4-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate (PubChem CID 72644805) has the molecular formula C20H31N5OS2 and a molecular weight of 421.64 g/mol. Its IUPAC name is ethyl N'-[[4-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | ethyl N'-[[4-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 72644805 |
| Molecular Formula | C20H31N5OS2 |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | ethyl N'-[[4-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate |
| SMILES | CCSC(N)=NC(=S)Nc1ccc(N2CCN(C(=O)CC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H31N5OS2/c1-5-28-18(21)23-19(27)22-15-6-8-16(9-7-15)24-10-12-25(13-11-24)17(26)14-20(2,3)4/h6-9H,5,10-14H2,1-4H3,(H3,21,22,23,27) |
| InChIKey | XDWCAURYIUKBHA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|