C18H32N5PS2 — CID 159557133
ethyl N'-[[4-(4-butan-2-ylpiperazin-1-yl)phenyl]carbamothioyl]carbamimidothioate;phosphane (PubChem CID 159557133) has the molecular formula C18H32N5PS2 and a molecular weight of 413.60 g/mol. Its IUPAC name is ethyl N'-[[4-(4-butan-2-ylpiperazin-1-yl)phenyl]carbamothioyl]carbamimidothioate;phosphane.
| Compound Name | ethyl N'-[[4-(4-butan-2-ylpiperazin-1-yl)phenyl]carbamothioyl]carbamimidothioate;phosphane |
|---|---|
| PubChem CID | 159557133 |
| Molecular Formula | C18H32N5PS2 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | ethyl N'-[[4-(4-butan-2-ylpiperazin-1-yl)phenyl]carbamothioyl]carbamimidothioate;phosphane |
| SMILES | CCSC(N)=NC(=S)Nc1ccc(N2CCN(C(C)CC)CC2)cc1.P |
| InChI | InChI=1S/C18H29N5S2.H3P/c1-4-14(3)22-10-12-23(13-11-22)16-8-6-15(7-9-16)20-18(24)21-17(19)25-5-2;/h6-9,14H,4-5,10-13H2,1-3H3,(H3,19,20,21,24);1H3 |
| InChIKey | MGDFMHIJXQXOJQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|