C23H31N5S2 — CID 142154018
benzyl N'-[[4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate (PubChem CID 142154018) has the molecular formula C23H31N5S2 and a molecular weight of 441.67 g/mol. Its IUPAC name is benzyl N'-[[4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | benzyl N'-[[4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 142154018 |
| Molecular Formula | C23H31N5S2 |
| Molecular Weight | 441.67 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | benzyl N'-[[4-[4-(2-methylpropyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate |
| SMILES | CC(C)CN1CCN(c2ccc(NC(=S)/N=C(\N)SCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H31N5S2/c1-18(2)16-27-12-14-28(15-13-27)21-10-8-20(9-11-21)25-23(29)26-22(24)30-17-19-6-4-3-5-7-19/h3-11,18H,12-17H2,1-2H3,(H3,24,25,26,29) |
| InChIKey | LXRIOROTIHHYGL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|