C19H29N5OS2 — CID 142154050
cyclobutylmethyl N'-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate (PubChem CID 142154050) has the molecular formula C19H29N5OS2 and a molecular weight of 407.61 g/mol. Its IUPAC name is cyclobutylmethyl N'-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | cyclobutylmethyl N'-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 142154050 |
| Molecular Formula | C19H29N5OS2 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | cyclobutylmethyl N'-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate |
| SMILES | N/C(=N\C(=S)Nc1ccc(N2CCN(CCO)CC2)cc1)SCC1CCC1 |
| InChI | InChI=1S/C19H29N5OS2/c20-18(27-14-15-2-1-3-15)22-19(26)21-16-4-6-17(7-5-16)24-10-8-23(9-11-24)12-13-25/h4-7,15,25H,1-3,8-14H2,(H3,20,21,22,26) |
| InChIKey | QHOKWZVEEGJXPS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|