C23H32N8O2S2 — CID 142154006
cyclopentylmethyl N'-[[4-[4-(3-azidooxy-4,4-dimethyloxet-2-yl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate (PubChem CID 142154006) has the molecular formula C23H32N8O2S2 and a molecular weight of 516.70 g/mol. Its IUPAC name is cyclopentylmethyl N'-[[4-[4-(3-azidooxy-4,4-dimethyloxet-2-yl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | cyclopentylmethyl N'-[[4-[4-(3-azidooxy-4,4-dimethyloxet-2-yl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 142154006 |
| Molecular Formula | C23H32N8O2S2 |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | cyclopentylmethyl N'-[[4-[4-(3-azidooxy-4,4-dimethyloxet-2-yl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate |
| SMILES | CC1(C)OC(N2CCN(c3ccc(NC(=S)/N=C(\N)SCC4CCCC4)cc3)CC2)=C1ON=[N+]=[N-] |
| InChI | InChI=1S/C23H32N8O2S2/c1-23(2)19(33-29-28-25)20(32-23)31-13-11-30(12-14-31)18-9-7-17(8-10-18)26-22(34)27-21(24)35-15-16-5-3-4-6-16/h7-10,16H,3-6,11-15H2,1-2H3,(H3,24,26,27,34) |
| InChIKey | BWGAAVOUNGQSFL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 124.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|