C29H46N4S2 — CID 143125205
1-[(E)-1-(cycloheptylmethylsulfanyl)but-1-enyl]-3-[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]thiourea (PubChem CID 143125205) has the molecular formula C29H46N4S2 and a molecular weight of 514.85 g/mol. Its IUPAC name is 1-[(E)-1-(cycloheptylmethylsulfanyl)but-1-enyl]-3-[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[(E)-1-(cycloheptylmethylsulfanyl)but-1-enyl]-3-[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 143125205 |
| Molecular Formula | C29H46N4S2 |
| Molecular Weight | 514.85 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | 1-[(E)-1-(cycloheptylmethylsulfanyl)but-1-enyl]-3-[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]thiourea |
| SMILES | CC/C=C(\NC(=S)Nc1ccc(N2CCC(N3CCCCC3)CC2)cc1)SCC1CCCCCC1 |
| InChI | InChI=1S/C29H46N4S2/c1-2-10-28(35-23-24-11-6-3-4-7-12-24)31-29(34)30-25-13-15-26(16-14-25)33-21-17-27(18-22-33)32-19-8-5-9-20-32/h10,13-16,24,27H,2-9,11-12,17-23H2,1H3,(H2,30,31,34)/b28-10+ |
| InChIKey | DCIBFIPOUXHGDR-ORBVJSQLSA-N |
| XLogP | 7.38 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.85 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|