C25H33N5S2 — CID 159688863
benzyl N'-[[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]carbamothioyl]carbamimidothioate (PubChem CID 159688863) has the molecular formula C25H33N5S2 and a molecular weight of 467.71 g/mol. Its IUPAC name is benzyl N'-[[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | benzyl N'-[[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 159688863 |
| Molecular Formula | C25H33N5S2 |
| Molecular Weight | 467.71 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | benzyl N'-[[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]carbamothioyl]carbamimidothioate |
| SMILES | NC(=NC(=S)Nc1ccc(N2CCC(N3CCCCC3)CC2)cc1)SCc1ccccc1 |
| InChI | InChI=1S/C25H33N5S2/c26-24(32-19-20-7-3-1-4-8-20)28-25(31)27-21-9-11-22(12-10-21)30-17-13-23(14-18-30)29-15-5-2-6-16-29/h1,3-4,7-12,23H,2,5-6,13-19H2,(H3,26,27,28,31) |
| InChIKey | MWDRFULZIDOEDM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|