C16H25N5OS2 — CID 20737708
ethyl N'-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate (PubChem CID 20737708) has the molecular formula C16H25N5OS2 and a molecular weight of 367.54 g/mol. Its IUPAC name is ethyl N'-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | ethyl N'-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 20737708 |
| Molecular Formula | C16H25N5OS2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | ethyl N'-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]carbamothioyl]carbamimidothioate |
| SMILES | CCS/C(N)=N/C(=S)Nc1ccc(N2CCN(CCO)CC2)cc1 |
| InChI | InChI=1S/C16H25N5OS2/c1-2-24-15(17)19-16(23)18-13-3-5-14(6-4-13)21-9-7-20(8-10-21)11-12-22/h3-6,22H,2,7-12H2,1H3,(H3,17,18,19,23) |
| InChIKey | KKWHQIMOTQINTF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|