C23H35N5OS2 — CID 143125204
cyclopentylmethyl N'-[[4-(4-morpholin-4-ylpiperidin-1-yl)phenyl]carbamothioyl]carbamimidothioate (PubChem CID 143125204) has the molecular formula C23H35N5OS2 and a molecular weight of 461.70 g/mol. Its IUPAC name is cyclopentylmethyl N'-[[4-(4-morpholin-4-ylpiperidin-1-yl)phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | cyclopentylmethyl N'-[[4-(4-morpholin-4-ylpiperidin-1-yl)phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 143125204 |
| Molecular Formula | C23H35N5OS2 |
| Molecular Weight | 461.70 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | cyclopentylmethyl N'-[[4-(4-morpholin-4-ylpiperidin-1-yl)phenyl]carbamothioyl]carbamimidothioate |
| SMILES | N/C(=N\C(=S)Nc1ccc(N2CCC(N3CCOCC3)CC2)cc1)SCC1CCCC1 |
| InChI | InChI=1S/C23H35N5OS2/c24-22(31-17-18-3-1-2-4-18)26-23(30)25-19-5-7-20(8-6-19)27-11-9-21(10-12-27)28-13-15-29-16-14-28/h5-8,18,21H,1-4,9-17H2,(H3,24,25,26,30) |
| InChIKey | DIWAWIZZVOCFET-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|