C26H33N5S2 — CID 163443531
cyclooctatetraenylmethyl N'-[[4-(4-cyclopentylpiperazin-1-yl)phenyl]carbamothioyl]carbamimidothioate (PubChem CID 163443531) has the molecular formula C26H33N5S2 and a molecular weight of 479.72 g/mol. Its IUPAC name is cyclooctatetraenylmethyl N'-[[4-(4-cyclopentylpiperazin-1-yl)phenyl]carbamothioyl]carbamimidothioate.
| Compound Name | cyclooctatetraenylmethyl N'-[[4-(4-cyclopentylpiperazin-1-yl)phenyl]carbamothioyl]carbamimidothioate |
|---|---|
| PubChem CID | 163443531 |
| Molecular Formula | C26H33N5S2 |
| Molecular Weight | 479.72 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | cyclooctatetraenylmethyl N'-[[4-(4-cyclopentylpiperazin-1-yl)phenyl]carbamothioyl]carbamimidothioate |
| SMILES | NC(=NC(=S)Nc1ccc(N2CCN(C3CCCC3)CC2)cc1)SCC1=CC=CC=CC=C1 |
| InChI | InChI=1S/C26H33N5S2/c27-25(33-20-21-8-4-2-1-3-5-9-21)29-26(32)28-22-12-14-24(15-13-22)31-18-16-30(17-19-31)23-10-6-7-11-23/h1-5,8-9,12-15,23H,6-7,10-11,16-20H2,(H3,27,28,29,32) |
| InChIKey | BAOPTIFKVSNYQQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|